C26H26N4O2S — CID 42741696
N-benzyl-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 42741696) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is N-benzyl-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-benzyl-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 42741696 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-benzyl-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | COc1cccc(-c2nnc(SCCCC(=O)NCc3ccccc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H26N4O2S/c1-32-23-15-8-12-21(18-23)25-28-29-26(30(25)22-13-6-3-7-14-22)33-17-9-16-24(31)27-19-20-10-4-2-5-11-20/h2-8,10-15,18H,9,16-17,19H2,1H3,(H,27,31) |
| InChIKey | LZJOFDCVUYBSKN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|