C28H28Cl2N4O2S — CID 5216969
N-[2-(2,4-dichlorophenyl)ethyl]-4-[[5-(3-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 5216969) has the molecular formula C28H28Cl2N4O2S and a molecular weight of 555.53 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-[[5-(3-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[[5-(3-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 5216969 |
| Molecular Formula | C28H28Cl2N4O2S |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[[5-(3-methoxyphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | COc1cccc(-c2nnc(SCCCC(=O)NCCc3ccc(Cl)cc3Cl)n2-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C28H28Cl2N4O2S/c1-19-8-12-23(13-9-19)34-27(21-5-3-6-24(17-21)36-2)32-33-28(34)37-16-4-7-26(35)31-15-14-20-10-11-22(29)18-25(20)30/h3,5-6,8-13,17-18H,4,7,14-16H2,1-2H3,(H,31,35) |
| InChIKey | YUTIAVCKJMPHBA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|