C34H34N4O2S — CID 42741712
N-(3,3-diphenylpropyl)-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 42741712) has the molecular formula C34H34N4O2S and a molecular weight of 562.74 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-(3,3-diphenylpropyl)-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 42741712 |
| Molecular Formula | C34H34N4O2S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | N-(3,3-diphenylpropyl)-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | COc1cccc(-c2nnc(SCCCC(=O)NCCC(c3ccccc3)c3ccccc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C34H34N4O2S/c1-40-30-20-11-17-28(25-30)33-36-37-34(38(33)29-18-9-4-10-19-29)41-24-12-21-32(39)35-23-22-31(26-13-5-2-6-14-26)27-15-7-3-8-16-27/h2-11,13-20,25,31H,12,21-24H2,1H3,(H,35,39) |
| InChIKey | WCOSHGKOSWQOQT-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|