C28H30N4O3S — CID 3976453
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide (PubChem CID 3976453) has the molecular formula C28H30N4O3S and a molecular weight of 502.64 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 3976453 |
| Molecular Formula | C28H30N4O3S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
| SMILES | COc1ccc(CCNC(=O)CCCSc2nnc(-c3ccccc3)n2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C28H30N4O3S/c1-34-24-16-15-21(20-25(24)35-2)17-18-29-26(33)14-9-19-36-28-31-30-27(22-10-5-3-6-11-22)32(28)23-12-7-4-8-13-23/h3-8,10-13,15-16,20H,9,14,17-19H2,1-2H3,(H,29,33) |
| InChIKey | SKHHYCDVFSQUJS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|