C30H34N4O3S — CID 42742294
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 42742294) has the molecular formula C30H34N4O3S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 42742294 |
| Molecular Formula | C30H34N4O3S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | COc1ccc(CCN(C)C(=O)CCCSc2nnc(-c3ccc(C)cc3)n2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H34N4O3S/c1-22-12-15-24(16-13-22)29-31-32-30(34(29)25-9-6-5-7-10-25)38-20-8-11-28(35)33(2)19-18-23-14-17-26(36-3)27(21-23)37-4/h5-7,9-10,12-17,21H,8,11,18-20H2,1-4H3 |
| InChIKey | FCSUTAOQZPPWMI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|