C31H33N5O3S — CID 6412671
4-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbutanamide (PubChem CID 6412671) has the molecular formula C31H33N5O3S and a molecular weight of 555.70 g/mol. Its IUPAC name is 4-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbutanamide.
| Compound Name | 4-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 6412671 |
| Molecular Formula | C31H33N5O3S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 4-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylbutanamide |
| SMILES | COc1ccc(CCN(C)C(=O)CCCSc2nnc3c4ccccc4n(Cc4ccccc4)c3n2)cc1OC |
| InChI | InChI=1S/C31H33N5O3S/c1-35(18-17-22-15-16-26(38-2)27(20-22)39-3)28(37)14-9-19-40-31-32-30-29(33-34-31)24-12-7-8-13-25(24)36(30)21-23-10-5-4-6-11-23/h4-8,10-13,15-16,20H,9,14,17-19,21H2,1-3H3 |
| InChIKey | XPOAFXBVHGTKGA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|