C35H33N5OS — CID 6414029
N-benzhydryl-5-[[5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide (PubChem CID 6414029) has the molecular formula C35H33N5OS and a molecular weight of 571.75 g/mol. Its IUPAC name is N-benzhydryl-5-[[5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-benzhydryl-5-[[5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 6414029 |
| Molecular Formula | C35H33N5OS |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | N-benzhydryl-5-[[5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
| SMILES | Cc1ccc(Cn2c3ccccc3c3nnc(SCCCCC(=O)NC(c4ccccc4)c4ccccc4)nc32)cc1 |
| InChI | InChI=1S/C35H33N5OS/c1-25-19-21-26(22-20-25)24-40-30-17-9-8-16-29(30)33-34(40)37-35(39-38-33)42-23-11-10-18-31(41)36-32(27-12-4-2-5-13-27)28-14-6-3-7-15-28/h2-9,12-17,19-22,32H,10-11,18,23-24H2,1H3,(H,36,41) |
| InChIKey | CAHRYAVLADCVMJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|