C28H26ClN5OS — CID 42737724
N-benzyl-5-[[5-[(3-chlorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide (PubChem CID 42737724) has the molecular formula C28H26ClN5OS and a molecular weight of 516.07 g/mol. Its IUPAC name is N-benzyl-5-[[5-[(3-chlorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-benzyl-5-[[5-[(3-chlorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 42737724 |
| Molecular Formula | C28H26ClN5OS |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | N-benzyl-5-[[5-[(3-chlorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
| SMILES | O=C(CCCCSc1nnc2c3ccccc3n(Cc3cccc(Cl)c3)c2n1)NCc1ccccc1 |
| InChI | InChI=1S/C28H26ClN5OS/c29-22-12-8-11-21(17-22)19-34-24-14-5-4-13-23(24)26-27(34)31-28(33-32-26)36-16-7-6-15-25(35)30-18-20-9-2-1-3-10-20/h1-5,8-14,17H,6-7,15-16,18-19H2,(H,30,35) |
| InChIKey | NDWHXWLWKVFERU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|