C27H32N6OS — CID 6414001
4-[[5-[(3-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-(2-pyrrolidin-1-ylethyl)butanamide (PubChem CID 6414001) has the molecular formula C27H32N6OS and a molecular weight of 488.66 g/mol. Its IUPAC name is 4-[[5-[(3-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-(2-pyrrolidin-1-ylethyl)butanamide.
| Compound Name | 4-[[5-[(3-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-(2-pyrrolidin-1-ylethyl)butanamide |
|---|---|
| PubChem CID | 6414001 |
| Molecular Formula | C27H32N6OS |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 4-[[5-[(3-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-(2-pyrrolidin-1-ylethyl)butanamide |
| SMILES | Cc1cccc(Cn2c3ccccc3c3nnc(SCCCC(=O)NCCN4CCCC4)nc32)c1 |
| InChI | InChI=1S/C27H32N6OS/c1-20-8-6-9-21(18-20)19-33-23-11-3-2-10-22(23)25-26(33)29-27(31-30-25)35-17-7-12-24(34)28-13-16-32-14-4-5-15-32/h2-3,6,8-11,18H,4-5,7,12-17,19H2,1H3,(H,28,34) |
| InChIKey | PFBAIFGKADTPBF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|