C20H16N4S — CID 42805991
5-[(3-methylphenyl)methyl]-3-prop-2-ynylsulfanyl-[1,2,4]triazino[5,6-b]indole (PubChem CID 42805991) has the molecular formula C20H16N4S and a molecular weight of 344.44 g/mol. Its IUPAC name is 5-[(3-methylphenyl)methyl]-3-prop-2-ynylsulfanyl-[1,2,4]triazino[5,6-b]indole.
| Compound Name | 5-[(3-methylphenyl)methyl]-3-prop-2-ynylsulfanyl-[1,2,4]triazino[5,6-b]indole |
|---|---|
| PubChem CID | 42805991 |
| Molecular Formula | C20H16N4S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5-[(3-methylphenyl)methyl]-3-prop-2-ynylsulfanyl-[1,2,4]triazino[5,6-b]indole |
| SMILES | C#CCSc1nnc2c3ccccc3n(Cc3cccc(C)c3)c2n1 |
| InChI | InChI=1S/C20H16N4S/c1-3-11-25-20-21-19-18(22-23-20)16-9-4-5-10-17(16)24(19)13-15-8-6-7-14(2)12-15/h1,4-10,12H,11,13H2,2H3 |
| InChIKey | PPVZDHMLJVMEHC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|