C24H27N5OS — CID 6413572
4-[[5-[(3-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-propylbutanamide (PubChem CID 6413572) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is 4-[[5-[(3-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-propylbutanamide.
| Compound Name | 4-[[5-[(3-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-propylbutanamide |
|---|---|
| PubChem CID | 6413572 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-[[5-[(3-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-propylbutanamide |
| SMILES | CCCNC(=O)CCCSc1nnc2c3ccccc3n(Cc3cccc(C)c3)c2n1 |
| InChI | InChI=1S/C24H27N5OS/c1-3-13-25-21(30)12-7-14-31-24-26-23-22(27-28-24)19-10-4-5-11-20(19)29(23)16-18-9-6-8-17(2)15-18/h4-6,8-11,15H,3,7,12-14,16H2,1-2H3,(H,25,30) |
| InChIKey | VZXYBJQBAKXFSB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|