C26H31N5OS — CID 42738772
N-butyl-5-[[5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide (PubChem CID 42738772) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is N-butyl-5-[[5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-butyl-5-[[5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 42738772 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | N-butyl-5-[[5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
| SMILES | CCCCNC(=O)CCCCSc1nnc2c3ccccc3n(Cc3ccc(C)cc3)c2n1 |
| InChI | InChI=1S/C26H31N5OS/c1-3-4-16-27-23(32)11-7-8-17-33-26-28-25-24(29-30-26)21-9-5-6-10-22(21)31(25)18-20-14-12-19(2)13-15-20/h5-6,9-10,12-15H,3-4,7-8,11,16-18H2,1-2H3,(H,27,32) |
| InChIKey | UNRYDVPLFQDPRF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|