C23H25N5OS — CID 42737938
2-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-butylpropanamide (PubChem CID 42737938) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-butylpropanamide.
| Compound Name | 2-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-butylpropanamide |
|---|---|
| PubChem CID | 42737938 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)Sc1nnc2c3ccccc3n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C23H25N5OS/c1-3-4-14-24-22(29)16(2)30-23-25-21-20(26-27-23)18-12-8-9-13-19(18)28(21)15-17-10-6-5-7-11-17/h5-13,16H,3-4,14-15H2,1-2H3,(H,24,29) |
| InChIKey | OIUSJHDREUDPPS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|