C37H37N5OS — CID 42738861
N-(1,2-diphenylethyl)-5-[[8-methyl-5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide (PubChem CID 42738861) has the molecular formula C37H37N5OS and a molecular weight of 599.80 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-5-[[8-methyl-5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-(1,2-diphenylethyl)-5-[[8-methyl-5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 42738861 |
| Molecular Formula | C37H37N5OS |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | N-(1,2-diphenylethyl)-5-[[8-methyl-5-[(4-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
| SMILES | Cc1ccc(Cn2c3ccc(C)cc3c3nnc(SCCCCC(=O)NC(Cc4ccccc4)c4ccccc4)nc32)cc1 |
| InChI | InChI=1S/C37H37N5OS/c1-26-16-19-29(20-17-26)25-42-33-21-18-27(2)23-31(33)35-36(42)39-37(41-40-35)44-22-10-9-15-34(43)38-32(30-13-7-4-8-14-30)24-28-11-5-3-6-12-28/h3-8,11-14,16-21,23,32H,9-10,15,22,24-25H2,1-2H3,(H,38,43) |
| InChIKey | MGWMCLLNVQKFDG-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|