C42H55N5O2S — CID 42737842
5-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]pentanamide (PubChem CID 42737842) has the molecular formula C42H55N5O2S and a molecular weight of 694.00 g/mol. Its IUPAC name is 5-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]pentanamide.
| Compound Name | 5-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]pentanamide |
|---|---|
| PubChem CID | 42737842 |
| Molecular Formula | C42H55N5O2S |
| Molecular Weight | 694.00 g/mol |
| Exact Mass | 693.41 |
| IUPAC Name | 5-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]pentanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)CCCCSc2nnc3c4cc(C)ccc4n(Cc4ccccc4)c3n2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C42H55N5O2S/c1-8-41(4,5)32-21-23-36(34(28-32)42(6,7)9-2)49-25-15-14-24-43-37(48)19-13-16-26-50-40-44-39-38(45-46-40)33-27-30(3)20-22-35(33)47(39)29-31-17-11-10-12-18-31/h10-12,17-18,20-23,27-28H,8-9,13-16,19,24-26,29H2,1-7H3,(H,43,48) |
| InChIKey | RCNFQMAZPUGUNT-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.00 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|