C34H44N6O2S — CID 42738171
1-[4-[4-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoyl]-2-methylpiperazin-1-yl]octan-1-one (PubChem CID 42738171) has the molecular formula C34H44N6O2S and a molecular weight of 600.83 g/mol. Its IUPAC name is 1-[4-[4-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoyl]-2-methylpiperazin-1-yl]octan-1-one.
| Compound Name | 1-[4-[4-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoyl]-2-methylpiperazin-1-yl]octan-1-one |
|---|---|
| PubChem CID | 42738171 |
| Molecular Formula | C34H44N6O2S |
| Molecular Weight | 600.83 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | 1-[4-[4-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]butanoyl]-2-methylpiperazin-1-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCN(C(=O)CCCSc2nnc3c4cc(C)ccc4n(Cc4ccccc4)c3n2)CC1C |
| InChI | InChI=1S/C34H44N6O2S/c1-4-5-6-7-11-15-31(42)39-20-19-38(23-26(39)3)30(41)16-12-21-43-34-35-33-32(36-37-34)28-22-25(2)17-18-29(28)40(33)24-27-13-9-8-10-14-27/h8-10,13-14,17-18,22,26H,4-7,11-12,15-16,19-21,23-24H2,1-3H3 |
| InChIKey | JHIMMEITASPDDJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.83 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|