C36H40N6O2S — CID 42738151
5-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[4-(4-ethylbenzoyl)-3-methylpiperazin-1-yl]pentan-1-one (PubChem CID 42738151) has the molecular formula C36H40N6O2S and a molecular weight of 620.82 g/mol. Its IUPAC name is 5-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[4-(4-ethylbenzoyl)-3-methylpiperazin-1-yl]pentan-1-one.
| Compound Name | 5-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[4-(4-ethylbenzoyl)-3-methylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 42738151 |
| Molecular Formula | C36H40N6O2S |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 5-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[4-(4-ethylbenzoyl)-3-methylpiperazin-1-yl]pentan-1-one |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)CCCCSc3nnc4c5cc(C)ccc5n(Cc5ccccc5)c4n3)CC2C)cc1 |
| InChI | InChI=1S/C36H40N6O2S/c1-4-27-14-16-29(17-15-27)35(44)41-20-19-40(23-26(41)3)32(43)12-8-9-21-45-36-37-34-33(38-39-36)30-22-25(2)13-18-31(30)42(34)24-28-10-6-5-7-11-28/h5-7,10-11,13-18,22,26H,4,8-9,12,19-21,23-24H2,1-3H3 |
| InChIKey | DGOYGBRVDFRCCK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|