C31H29N7O4S — CID 42738100
2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]ethanone (PubChem CID 42738100) has the molecular formula C31H29N7O4S and a molecular weight of 595.69 g/mol. Its IUPAC name is 2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 42738100 |
| Molecular Formula | C31H29N7O4S |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc2c(c1)c1nnc(SCC(=O)N3CCN(C(=O)c4ccc([N+](=O)[O-])cc4)C(C)C3)nc1n2Cc1ccccc1 |
| InChI | InChI=1S/C31H29N7O4S/c1-20-8-13-26-25(16-20)28-29(37(26)18-22-6-4-3-5-7-22)32-31(34-33-28)43-19-27(39)35-14-15-36(21(2)17-35)30(40)23-9-11-24(12-10-23)38(41)42/h3-13,16,21H,14-15,17-19H2,1-2H3 |
| InChIKey | UMPKXQRJGVFPCL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|