C33H42N6O2S — CID 42658656
1-[4-[2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetyl]-2-methylpiperazin-1-yl]nonan-1-one (PubChem CID 42658656) has the molecular formula C33H42N6O2S and a molecular weight of 586.81 g/mol. Its IUPAC name is 1-[4-[2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetyl]-2-methylpiperazin-1-yl]nonan-1-one.
| Compound Name | 1-[4-[2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetyl]-2-methylpiperazin-1-yl]nonan-1-one |
|---|---|
| PubChem CID | 42658656 |
| Molecular Formula | C33H42N6O2S |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 1-[4-[2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetyl]-2-methylpiperazin-1-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCN(C(=O)CSc2nnc3c4cc(C)ccc4n(Cc4ccccc4)c3n2)CC1C |
| InChI | InChI=1S/C33H42N6O2S/c1-4-5-6-7-8-12-15-29(40)38-19-18-37(21-25(38)3)30(41)23-42-33-34-32-31(35-36-33)27-20-24(2)16-17-28(27)39(32)22-26-13-10-9-11-14-26/h9-11,13-14,16-17,20,25H,4-8,12,15,18-19,21-23H2,1-3H3 |
| InChIKey | TWCYHMYTKOOWRN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|