C31H28N8O6S — CID 42738099
2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[4-(3,5-dinitrobenzoyl)-3-methylpiperazin-1-yl]ethanone (PubChem CID 42738099) has the molecular formula C31H28N8O6S and a molecular weight of 640.68 g/mol. Its IUPAC name is 2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[4-(3,5-dinitrobenzoyl)-3-methylpiperazin-1-yl]ethanone.
| Compound Name | 2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[4-(3,5-dinitrobenzoyl)-3-methylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 42738099 |
| Molecular Formula | C31H28N8O6S |
| Molecular Weight | 640.68 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | 2-[(5-benzyl-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[4-(3,5-dinitrobenzoyl)-3-methylpiperazin-1-yl]ethanone |
| SMILES | Cc1ccc2c(c1)c1nnc(SCC(=O)N3CCN(C(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)C(C)C3)nc1n2Cc1ccccc1 |
| InChI | InChI=1S/C31H28N8O6S/c1-19-8-9-26-25(12-19)28-29(37(26)17-21-6-4-3-5-7-21)32-31(34-33-28)46-18-27(40)35-10-11-36(20(2)16-35)30(41)22-13-23(38(42)43)15-24(14-22)39(44)45/h3-9,12-15,20H,10-11,16-18H2,1-2H3 |
| InChIKey | FXMMZQDEFOLESE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 170.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|