C32H30BrN7O4S — CID 42658605
4-[[5-[(4-bromophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 42658605) has the molecular formula C32H30BrN7O4S and a molecular weight of 688.61 g/mol. Its IUPAC name is 4-[[5-[(4-bromophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-[[5-[(4-bromophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 42658605 |
| Molecular Formula | C32H30BrN7O4S |
| Molecular Weight | 688.61 g/mol |
| Exact Mass | 687.13 |
| IUPAC Name | 4-[[5-[(4-bromophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | CC1CN(C(=O)CCCSc2nnc3c4ccccc4n(Cc4ccc(Br)cc4)c3n2)CCN1C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H30BrN7O4S/c1-21-19-37(15-16-38(21)31(42)23-6-4-7-25(18-23)40(43)44)28(41)10-5-17-45-32-34-30-29(35-36-32)26-8-2-3-9-27(26)39(30)20-22-11-13-24(33)14-12-22/h2-4,6-9,11-14,18,21H,5,10,15-17,19-20H2,1H3 |
| InChIKey | AYRNQPHALVPSAH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|