C25H28FN5O2S — CID 42738947
4-[[5-[(2-fluorophenyl)methyl]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-(3-methoxypropyl)butanamide (PubChem CID 42738947) has the molecular formula C25H28FN5O2S and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-[[5-[(2-fluorophenyl)methyl]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-(3-methoxypropyl)butanamide.
| Compound Name | 4-[[5-[(2-fluorophenyl)methyl]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-(3-methoxypropyl)butanamide |
|---|---|
| PubChem CID | 42738947 |
| Molecular Formula | C25H28FN5O2S |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 4-[[5-[(2-fluorophenyl)methyl]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-(3-methoxypropyl)butanamide |
| SMILES | COCCCNC(=O)CCCSc1nnc2c3cc(C)ccc3n(Cc3ccccc3F)c2n1 |
| InChI | InChI=1S/C25H28FN5O2S/c1-17-10-11-21-19(15-17)23-24(31(21)16-18-7-3-4-8-20(18)26)28-25(30-29-23)34-14-5-9-22(32)27-12-6-13-33-2/h3-4,7-8,10-11,15H,5-6,9,12-14,16H2,1-2H3,(H,27,32) |
| InChIKey | ALVGXEDRFVJFJP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|