C25H28FN5OS — CID 42738958
N-butyl-2-[[5-[(2-fluorophenyl)methyl]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]butanamide (PubChem CID 42738958) has the molecular formula C25H28FN5OS and a molecular weight of 465.60 g/mol. Its IUPAC name is N-butyl-2-[[5-[(2-fluorophenyl)methyl]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]butanamide.
| Compound Name | N-butyl-2-[[5-[(2-fluorophenyl)methyl]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 42738958 |
| Molecular Formula | C25H28FN5OS |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-butyl-2-[[5-[(2-fluorophenyl)methyl]-8-methyl-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]butanamide |
| SMILES | CCCCNC(=O)C(CC)Sc1nnc2c3cc(C)ccc3n(Cc3ccccc3F)c2n1 |
| InChI | InChI=1S/C25H28FN5OS/c1-4-6-13-27-24(32)21(5-2)33-25-28-23-22(29-30-25)18-14-16(3)11-12-20(18)31(23)15-17-9-7-8-10-19(17)26/h7-12,14,21H,4-6,13,15H2,1-3H3,(H,27,32) |
| InChIKey | DLWNSTQYUABBEC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|