C25H29N5OS — CID 42738560
5-[[5-[(2-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-propan-2-ylpentanamide (PubChem CID 42738560) has the molecular formula C25H29N5OS and a molecular weight of 447.61 g/mol. Its IUPAC name is 5-[[5-[(2-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-propan-2-ylpentanamide.
| Compound Name | 5-[[5-[(2-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 42738560 |
| Molecular Formula | C25H29N5OS |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 5-[[5-[(2-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N-propan-2-ylpentanamide |
| SMILES | Cc1ccccc1Cn1c2ccccc2c2nnc(SCCCCC(=O)NC(C)C)nc21 |
| InChI | InChI=1S/C25H29N5OS/c1-17(2)26-22(31)14-8-9-15-32-25-27-24-23(28-29-25)20-12-6-7-13-21(20)30(24)16-19-11-5-4-10-18(19)3/h4-7,10-13,17H,8-9,14-16H2,1-3H3,(H,26,31) |
| InChIKey | TUZBJWDWLGYTLP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|