C27H33N5OS — CID 42737820
4-[[5-[(2-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N,N-dipropylbutanamide (PubChem CID 42737820) has the molecular formula C27H33N5OS and a molecular weight of 475.66 g/mol. Its IUPAC name is 4-[[5-[(2-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N,N-dipropylbutanamide.
| Compound Name | 4-[[5-[(2-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N,N-dipropylbutanamide |
|---|---|
| PubChem CID | 42737820 |
| Molecular Formula | C27H33N5OS |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 4-[[5-[(2-methylphenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)CCCSc1nnc2c3ccccc3n(Cc3ccccc3C)c2n1 |
| InChI | InChI=1S/C27H33N5OS/c1-4-16-31(17-5-2)24(33)15-10-18-34-27-28-26-25(29-30-27)22-13-8-9-14-23(22)32(26)19-21-12-7-6-11-20(21)3/h6-9,11-14H,4-5,10,15-19H2,1-3H3 |
| InChIKey | DZPFZEAPNQNJJJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|