C30H40N6OS — CID 42737587
5-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(diethylamino)pentan-2-yl]pentanamide (PubChem CID 42737587) has the molecular formula C30H40N6OS and a molecular weight of 532.76 g/mol. Its IUPAC name is 5-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(diethylamino)pentan-2-yl]pentanamide.
| Compound Name | 5-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(diethylamino)pentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 42737587 |
| Molecular Formula | C30H40N6OS |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 5-[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-(diethylamino)pentan-2-yl]pentanamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)CCCCSc1nnc2c3ccccc3n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C30H40N6OS/c1-4-35(5-2)20-13-14-23(3)31-27(37)19-11-12-21-38-30-32-29-28(33-34-30)25-17-9-10-18-26(25)36(29)22-24-15-7-6-8-16-24/h6-10,15-18,23H,4-5,11-14,19-22H2,1-3H3,(H,31,37) |
| InChIKey | UOKGBAKEHMWDNZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|