C28H25F2N5OS — CID 42739185
N-benzyl-5-[[8-fluoro-5-[(4-fluorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide (PubChem CID 42739185) has the molecular formula C28H25F2N5OS and a molecular weight of 517.61 g/mol. Its IUPAC name is N-benzyl-5-[[8-fluoro-5-[(4-fluorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-benzyl-5-[[8-fluoro-5-[(4-fluorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 42739185 |
| Molecular Formula | C28H25F2N5OS |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N-benzyl-5-[[8-fluoro-5-[(4-fluorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]pentanamide |
| SMILES | O=C(CCCCSc1nnc2c3cc(F)ccc3n(Cc3ccc(F)cc3)c2n1)NCc1ccccc1 |
| InChI | InChI=1S/C28H25F2N5OS/c29-21-11-9-20(10-12-21)18-35-24-14-13-22(30)16-23(24)26-27(35)32-28(34-33-26)37-15-5-4-8-25(36)31-17-19-6-2-1-3-7-19/h1-3,6-7,9-14,16H,4-5,8,15,17-18H2,(H,31,36) |
| InChIKey | KYCYKJXOGVECOL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|