C26H27F2N5OS — CID 42739193
N-cyclohexyl-4-[[8-fluoro-5-[(4-fluorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]butanamide (PubChem CID 42739193) has the molecular formula C26H27F2N5OS and a molecular weight of 495.60 g/mol. Its IUPAC name is N-cyclohexyl-4-[[8-fluoro-5-[(4-fluorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]butanamide.
| Compound Name | N-cyclohexyl-4-[[8-fluoro-5-[(4-fluorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 42739193 |
| Molecular Formula | C26H27F2N5OS |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-cyclohexyl-4-[[8-fluoro-5-[(4-fluorophenyl)methyl]-[1,2,4]triazino[5,6-b]indol-3-yl]sulfanyl]butanamide |
| SMILES | O=C(CCCSc1nnc2c3cc(F)ccc3n(Cc3ccc(F)cc3)c2n1)NC1CCCCC1 |
| InChI | InChI=1S/C26H27F2N5OS/c27-18-10-8-17(9-11-18)16-33-22-13-12-19(28)15-21(22)24-25(33)30-26(32-31-24)35-14-4-7-23(34)29-20-5-2-1-3-6-20/h8-13,15,20H,1-7,14,16H2,(H,29,34) |
| InChIKey | YERNXEGHXAJSPA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|