C30H32ClN3O4S — CID 42735297
5-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpentanamide (PubChem CID 42735297) has the molecular formula C30H32ClN3O4S and a molecular weight of 566.12 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpentanamide.
| Compound Name | 5-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 42735297 |
| Molecular Formula | C30H32ClN3O4S |
| Molecular Weight | 566.12 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpentanamide |
| SMILES | COc1ccc(CCN(C)C(=O)CCCCSc2nc3ccccc3c(=O)n2-c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C30H32ClN3O4S/c1-33(18-17-21-11-16-26(37-2)27(20-21)38-3)28(35)10-6-7-19-39-30-32-25-9-5-4-8-24(25)29(36)34(30)23-14-12-22(31)13-15-23/h4-5,8-9,11-16,20H,6-7,10,17-19H2,1-3H3 |
| InChIKey | NDPCAKHMMRYPMJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.12 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|