C24H21ClN2O3S — CID 4566776
2-[2-(4-chlorophenoxy)ethylsulfanyl]-3-(4-ethoxyphenyl)quinazolin-4-one (PubChem CID 4566776) has the molecular formula C24H21ClN2O3S and a molecular weight of 452.96 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethylsulfanyl]-3-(4-ethoxyphenyl)quinazolin-4-one.
| Compound Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-3-(4-ethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 4566776 |
| Molecular Formula | C24H21ClN2O3S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-3-(4-ethoxyphenyl)quinazolin-4-one |
| SMILES | CCOc1ccc(-n2c(SCCOc3ccc(Cl)cc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H21ClN2O3S/c1-2-29-19-13-9-18(10-14-19)27-23(28)21-5-3-4-6-22(21)26-24(27)31-16-15-30-20-11-7-17(25)8-12-20/h3-14H,2,15-16H2,1H3 |
| InChIKey | TZGSVTTVFROOKE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|