C24H20Cl2N2O3S — CID 3957452
2-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-3-(4-ethoxyphenyl)quinazolin-4-one (PubChem CID 3957452) has the molecular formula C24H20Cl2N2O3S and a molecular weight of 487.41 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-3-(4-ethoxyphenyl)quinazolin-4-one.
| Compound Name | 2-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-3-(4-ethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3957452 |
| Molecular Formula | C24H20Cl2N2O3S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 2-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-3-(4-ethoxyphenyl)quinazolin-4-one |
| SMILES | CCOc1ccc(-n2c(SCCOc3ccc(Cl)cc3Cl)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H20Cl2N2O3S/c1-2-30-18-10-8-17(9-11-18)28-23(29)19-5-3-4-6-21(19)27-24(28)32-14-13-31-22-12-7-16(25)15-20(22)26/h3-12,15H,2,13-14H2,1H3 |
| InChIKey | BOOJFEDWAQMSTR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|