C26H26N2O5S — CID 3462094
3-(3,4-dimethoxyphenyl)-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]quinazolin-4-one (PubChem CID 3462094) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 3462094 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]quinazolin-4-one |
| SMILES | CCOc1ccc(OCCSc2nc3ccccc3c(=O)n2-c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H26N2O5S/c1-4-32-19-10-12-20(13-11-19)33-15-16-34-26-27-22-8-6-5-7-21(22)25(29)28(26)18-9-14-23(30-2)24(17-18)31-3/h5-14,17H,4,15-16H2,1-3H3 |
| InChIKey | QXUQKELLRRNODQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|