C30H33N5O5S — CID 3609386
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide (PubChem CID 3609386) has the molecular formula C30H33N5O5S and a molecular weight of 575.69 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 3609386 |
| Molecular Formula | C30H33N5O5S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
| SMILES | COc1ccc(CCN(C)C(=O)CCCCSc2nnc(-c3ccc([N+](=O)[O-])cc3)n2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H33N5O5S/c1-33(19-18-22-12-17-26(39-2)27(21-22)40-3)28(36)11-7-8-20-41-30-32-31-29(34(30)24-9-5-4-6-10-24)23-13-15-25(16-14-23)35(37)38/h4-6,9-10,12-17,21H,7-8,11,18-20H2,1-3H3 |
| InChIKey | SEWLBKXTRDVKNQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 112.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|