C19H16ClN3OS — CID 2561551
5-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile (PubChem CID 2561551) has the molecular formula C19H16ClN3OS and a molecular weight of 369.88 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile.
| Compound Name | 5-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile |
|---|---|
| PubChem CID | 2561551 |
| Molecular Formula | C19H16ClN3OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile |
| SMILES | N#CCCCCSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3OS/c20-14-8-10-15(11-9-14)23-18(24)16-6-2-3-7-17(16)22-19(23)25-13-5-1-4-12-21/h2-3,6-11H,1,4-5,13H2 |
| InChIKey | NHBDUMLPBWNTPF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|