C26H21N3O3S — CID 16535355
2-[4-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutyl]isoindole-1,3-dione (PubChem CID 16535355) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-[4-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 16535355 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-[4-(4-oxo-3-phenylquinazolin-2-yl)sulfanylbutyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCSc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C26H21N3O3S/c30-23-19-12-4-5-13-20(19)24(31)28(23)16-8-9-17-33-26-27-22-15-7-6-14-21(22)25(32)29(26)18-10-2-1-3-11-18/h1-7,10-15H,8-9,16-17H2 |
| InChIKey | PZECBLMDNVIBKE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|