C21H24ClN3OS — CID 52997902
3-phenyl-2-(2-piperidin-1-ylethylsulfanyl)quinazolin-4-one;hydrochloride (PubChem CID 52997902) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is 3-phenyl-2-(2-piperidin-1-ylethylsulfanyl)quinazolin-4-one;hydrochloride.
| Compound Name | 3-phenyl-2-(2-piperidin-1-ylethylsulfanyl)quinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 52997902 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3-phenyl-2-(2-piperidin-1-ylethylsulfanyl)quinazolin-4-one;hydrochloride |
| SMILES | Cl.O=c1c2ccccc2nc(SCCN2CCCCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H23N3OS.ClH/c25-20-18-11-5-6-12-19(18)22-21(24(20)17-9-3-1-4-10-17)26-16-15-23-13-7-2-8-14-23;/h1,3-6,9-12H,2,7-8,13-16H2;1H |
| InChIKey | SMRQRKYBDKHSFL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |