C16H13N3O2S — CID 680931
2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 680931) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | 2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 680931 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | NC(=O)CSc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C16H13N3O2S/c17-14(20)10-22-16-18-13-9-5-4-8-12(13)15(21)19(16)11-6-2-1-3-7-11/h1-9H,10H2,(H2,17,20) |
| InChIKey | CUHQQCFNTSQCIV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |