C17H14ClN3O3S — CID 2680991
2-[3-(3-chloro-4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 2680991) has the molecular formula C17H14ClN3O3S and a molecular weight of 375.84 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | 2-[3-(3-chloro-4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2680991 |
| Molecular Formula | C17H14ClN3O3S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 2-[3-(3-chloro-4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(-n2c(SCC(N)=O)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C17H14ClN3O3S/c1-24-14-7-6-10(8-12(14)18)21-16(23)11-4-2-3-5-13(11)20-17(21)25-9-15(19)22/h2-8H,9H2,1H3,(H2,19,22) |
| InChIKey | SYINULKHYAAPTM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |