C21H20ClN3O3S — CID 2607811
3-(3-chloro-4-methoxyphenyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylquinazolin-4-one (PubChem CID 2607811) has the molecular formula C21H20ClN3O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylquinazolin-4-one.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2607811 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylquinazolin-4-one |
| SMILES | COc1ccc(-n2c(SCC(=O)N3CCCC3)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C21H20ClN3O3S/c1-28-18-9-8-14(12-16(18)22)25-20(27)15-6-2-3-7-17(15)23-21(25)29-13-19(26)24-10-4-5-11-24/h2-3,6-9,12H,4-5,10-11,13H2,1H3 |
| InChIKey | JCXHGQBTGTYXJO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |