C27H27ClN2O3S — CID 3977146
2-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-3-(3-chloro-4-methoxyphenyl)quinazolin-4-one (PubChem CID 3977146) has the molecular formula C27H27ClN2O3S and a molecular weight of 495.04 g/mol. Its IUPAC name is 2-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-3-(3-chloro-4-methoxyphenyl)quinazolin-4-one.
| Compound Name | 2-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-3-(3-chloro-4-methoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3977146 |
| Molecular Formula | C27H27ClN2O3S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-3-(3-chloro-4-methoxyphenyl)quinazolin-4-one |
| SMILES | COc1ccc(-n2c(SCC(=O)C34CC5CC(CC(C5)C3)C4)nc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C27H27ClN2O3S/c1-33-23-7-6-19(11-21(23)28)30-25(32)20-4-2-3-5-22(20)29-26(30)34-15-24(31)27-12-16-8-17(13-27)10-18(9-16)14-27/h2-7,11,16-18H,8-10,12-15H2,1H3 |
| InChIKey | QZJYYEDXPNXMGB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |