C27H26F2N2O3S — CID 3903373
2-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-3-[4-(difluoromethoxy)phenyl]quinazolin-4-one (PubChem CID 3903373) has the molecular formula C27H26F2N2O3S and a molecular weight of 496.58 g/mol. Its IUPAC name is 2-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-3-[4-(difluoromethoxy)phenyl]quinazolin-4-one.
| Compound Name | 2-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-3-[4-(difluoromethoxy)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 3903373 |
| Molecular Formula | C27H26F2N2O3S |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-[2-(1-adamantyl)-2-oxoethyl]sulfanyl-3-[4-(difluoromethoxy)phenyl]quinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccc(OC(F)F)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H26F2N2O3S/c28-25(29)34-20-7-5-19(6-8-20)31-24(33)21-3-1-2-4-22(21)30-26(31)35-15-23(32)27-12-16-9-17(13-27)11-18(10-16)14-27/h1-8,16-18,25H,9-15H2 |
| InChIKey | BSOOGCJPQISWJT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |