C22H15F3N2O2S — CID 2478016
3-[4-(difluoromethoxy)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]quinazolin-4-one (PubChem CID 2478016) has the molecular formula C22H15F3N2O2S and a molecular weight of 428.44 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 2478016 |
| Molecular Formula | C22H15F3N2O2S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2ccccc2F)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H15F3N2O2S/c23-18-7-3-1-5-14(18)13-30-22-26-19-8-4-2-6-17(19)20(28)27(22)15-9-11-16(12-10-15)29-21(24)25/h1-12,21H,13H2 |
| InChIKey | CMMMOOQDXBXJIV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |