C22H17FN2OS — CID 175667679
2-[(2-fluorophenyl)methylsulfanyl]-6-methyl-3-phenylquinazolin-4-one (PubChem CID 175667679) has the molecular formula C22H17FN2OS and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methylsulfanyl]-6-methyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[(2-fluorophenyl)methylsulfanyl]-6-methyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 175667679 |
| Molecular Formula | C22H17FN2OS |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[(2-fluorophenyl)methylsulfanyl]-6-methyl-3-phenylquinazolin-4-one |
| SMILES | Cc1ccc2nc(SCc3ccccc3F)n(-c3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C22H17FN2OS/c1-15-11-12-20-18(13-15)21(26)25(17-8-3-2-4-9-17)22(24-20)27-14-16-7-5-6-10-19(16)23/h2-13H,14H2,1H3 |
| InChIKey | FSOLNMJRZFEVQU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |