C27H29N3O3S — CID 5219561
N-(1-adamantyl)-2-[3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 5219561) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(1-adamantyl)-2-[3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 5219561 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-(1-adamantyl)-2-[3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | COc1cccc(-n2c(SCC(=O)NC34CC5CC(CC(C5)C3)C4)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C27H29N3O3S/c1-33-21-6-4-5-20(12-21)30-25(32)22-7-2-3-8-23(22)28-26(30)34-16-24(31)29-27-13-17-9-18(14-27)11-19(10-17)15-27/h2-8,12,17-19H,9-11,13-16H2,1H3,(H,29,31) |
| InChIKey | UIAFAIIRUVTTOF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |