C25H22N4O4S — CID 27905509
4-[[2-[3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-N-methylbenzamide (PubChem CID 27905509) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is 4-[[2-[3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-N-methylbenzamide.
| Compound Name | 4-[[2-[3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 27905509 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 4-[[2-[3-(3-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)CSc2nc3ccccc3c(=O)n2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C25H22N4O4S/c1-26-23(31)16-10-12-17(13-11-16)27-22(30)15-34-25-28-21-9-4-3-8-20(21)24(32)29(25)18-6-5-7-19(14-18)33-2/h3-14H,15H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | GSUFREBAGGAJKO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |