C26H19N3O2S — CID 4666942
N-naphthalen-2-yl-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 4666942) has the molecular formula C26H19N3O2S and a molecular weight of 437.52 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-naphthalen-2-yl-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4666942 |
| Molecular Formula | C26H19N3O2S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-naphthalen-2-yl-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccccc1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H19N3O2S/c30-24(27-20-15-14-18-8-4-5-9-19(18)16-20)17-32-26-28-23-13-7-6-12-22(23)25(31)29(26)21-10-2-1-3-11-21/h1-16H,17H2,(H,27,30) |
| InChIKey | VRTVCHWQZRFAEO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |