C22H15FIN3O2S — CID 2344087
2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-iodophenyl)acetamide (PubChem CID 2344087) has the molecular formula C22H15FIN3O2S and a molecular weight of 531.35 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 2344087 |
| Molecular Formula | C22H15FIN3O2S |
| Molecular Weight | 531.35 g/mol |
| Exact Mass | 530.99 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C22H15FIN3O2S/c23-14-5-11-17(12-6-14)27-21(29)18-3-1-2-4-19(18)26-22(27)30-13-20(28)25-16-9-7-15(24)8-10-16/h1-12H,13H2,(H,25,28) |
| InChIKey | HBDLWNWXGRBWHQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|