C25H22ClN3O2S — CID 23938230
N-(4-chlorophenyl)-2-[4-oxo-3-(4-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 23938230) has the molecular formula C25H22ClN3O2S and a molecular weight of 463.99 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-oxo-3-(4-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-oxo-3-(4-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 23938230 |
| Molecular Formula | C25H22ClN3O2S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-oxo-3-(4-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)c1ccc(-n2c(SCC(=O)Nc3ccc(Cl)cc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H22ClN3O2S/c1-16(2)17-7-13-20(14-8-17)29-24(31)21-5-3-4-6-22(21)28-25(29)32-15-23(30)27-19-11-9-18(26)10-12-19/h3-14,16H,15H2,1-2H3,(H,27,30) |
| InChIKey | AHZOHYPAORLHOI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |