C21H22ClN3O2S — CID 5009022
2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-pentan-2-ylacetamide (PubChem CID 5009022) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-pentan-2-ylacetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 5009022 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O2S/c1-3-6-14(2)23-19(26)13-28-21-24-18-8-5-4-7-17(18)20(27)25(21)16-11-9-15(22)10-12-16/h4-5,7-12,14H,3,6,13H2,1-2H3,(H,23,26) |
| InChIKey | MABNCHGTOULFIW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |