C22H22N4O2S — CID 16576594
2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-pentan-2-ylacetamide (PubChem CID 16576594) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-pentan-2-ylacetamide.
| Compound Name | 2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 16576594 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-3-6-15(2)24-20(27)14-29-22-25-19-8-5-4-7-18(19)21(28)26(22)17-11-9-16(13-23)10-12-17/h4-5,7-12,15H,3,6,14H2,1-2H3,(H,24,27) |
| InChIKey | HPTJENKTRKXZCY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |